CAS 1160261-34-6
:7,8-Dimethyl-2-(4-methylphenyl)-4-quinolinecarbonyl chloride
Description:
7,8-Dimethyl-2-(4-methylphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, particularly acylation. The presence of two methyl groups at the 7 and 8 positions of the quinoline ring and a para-methylphenyl substituent at the 2 position contributes to its unique chemical properties and potential biological activity. The compound is likely to be a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity as an acyl chloride suggests it can be used in the synthesis of other chemical entities, particularly in the formation of amides or esters. Safety precautions should be taken when handling this compound due to its reactive nature and potential hazards associated with the carbonyl chloride functional group.
Formula:C19H16ClNO
InChI:InChI=1S/C19H16ClNO/c1-11-4-7-14(8-5-11)17-10-16(19(20)22)15-9-6-12(2)13(3)18(15)21-17/h4-10H,1-3H3
InChI key:InChIKey=ZXBKLVLIIMCQJZ-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C)C=C3)C(C)=C(C)C=C2
Synonyms:- 7,8-Dimethyl-2-(4-methylphenyl)-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 7,8-dimethyl-2-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.