CAS 1160261-41-5

2-(5-Chloro-2-thienyl)-7,8-dimethyl-4-quinolinecarbonyl chloride

Description:

2-(5-Chloro-2-thienyl)-7,8-dimethyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with a thienyl group and multiple methyl groups. The presence of a carbonyl chloride functional group indicates that it is a reactive acyl chloride, making it useful in various chemical reactions, particularly in acylation processes. The chlorine atom in the thienyl ring contributes to the compound's reactivity and potential biological activity. This compound may exhibit properties typical of quinoline derivatives, such as antimicrobial or antitumor activity, although specific biological data would need to be referenced for confirmation. Its synthesis and handling require careful consideration of safety protocols due to the reactivity of the acyl chloride group. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry and material science.

Formula: C₁₆H₁₁Cl₂NOS

InChI: InChI=1S/C16H11Cl2NOS/c1-8-3-4-10-11(16(18)20)7-12(19-15(10)9(8)2)13-5-6-14(17)21-13/h3-7H,1-2H3

InChI key: InChIKey=PJAWCNPKUFJAAQ-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C=3SC(Cl)=CC3)C(C)=C(C)C=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(5-chloro-2-thienyl)-7,8-dimethyl-
• 2-(5-Chloro-2-thienyl)-7,8-dimethyl-4-quinolinecarbonyl chloride