CAS 1160261-43-7

2-(5-Ethyl-2-thienyl)-7,8-dimethyl-4-quinolinecarbonyl chloride

Description:

2-(5-Ethyl-2-thienyl)-7,8-dimethyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core, a thienyl group, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic molecules, such as reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The thienyl and quinoline moieties contribute to its potential biological activity and may influence its solubility and stability in various solvents. Additionally, the presence of ethyl and methyl substituents can affect the compound's steric hindrance and electronic properties, potentially impacting its interactions with biological targets. As a chlorinated derivative, it may also exhibit unique spectral characteristics, making it suitable for applications in medicinal chemistry or as an intermediate in organic synthesis. Safety and handling precautions are essential due to the reactive nature of the carbonyl chloride group.

Formula: C₁₈H₁₆ClNOS

InChI: InChI=1S/C18H16ClNOS/c1-4-12-6-8-16(22-12)15-9-14(18(19)21)13-7-5-10(2)11(3)17(13)20-15/h5-9H,4H2,1-3H3

InChI key: InChIKey=YNPJPFWFRBPMNG-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C=3SC(CC)=CC3)C(C)=C(C)C=C2

Synonyms:

• 2-(5-Ethyl-2-thienyl)-7,8-dimethyl-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(5-ethyl-2-thienyl)-7,8-dimethyl-