CAS 1160262-72-5
:6,8-Dimethyl-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarbonyl chloride
Description:
6,8-Dimethyl-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a carbonyl chloride functional group. This compound features multiple methyl groups, contributing to its hydrophobic nature and potentially influencing its solubility in organic solvents. The presence of the carbonyl chloride group indicates that it can participate in nucleophilic substitution reactions, making it a versatile intermediate in organic synthesis. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the quinoline framework, which is known for its biological activity. Additionally, the branched alkyl substituent may enhance its lipophilicity, affecting its interaction with biological membranes. Overall, this compound exemplifies the complexity and diversity of synthetic organic chemistry, with implications for various chemical applications. However, specific safety and handling guidelines should be followed due to the reactive nature of the carbonyl chloride functional group.
Formula:C22H22ClNO
InChI:InChI=1S/C22H22ClNO/c1-13(2)9-16-5-7-17(8-6-16)20-12-19(22(23)25)18-11-14(3)10-15(4)21(18)24-20/h5-8,10-13H,9H2,1-4H3
InChI key:InChIKey=UNJYXRBOIDTGDC-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(CC(C)C)C=C3)C(C)=CC(C)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 6,8-dimethyl-2-[4-(2-methylpropyl)phenyl]-
- 6,8-Dimethyl-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.