CAS 1160262-80-5

2-(4-Bromophenyl)-6,8-dimethyl-4-quinolinecarbonyl chloride

Description:

2-(4-Bromophenyl)-6,8-dimethyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline ring system substituted with a bromophenyl group and two methyl groups. This compound features a carbonyl chloride functional group, which is indicative of its reactivity, particularly in acylation reactions. The presence of the bromine atom enhances its electrophilic character, making it useful in various synthetic applications. The methyl groups contribute to the compound's hydrophobicity and influence its solubility in organic solvents. As a quinoline derivative, it may exhibit biological activity, potentially serving as a scaffold for drug development. The compound's molecular structure suggests it could participate in diverse chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in organic synthesis and medicinal chemistry. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods and are essential for practical applications in research and industry.

Formula: C₁₈H₁₃BrClNO

InChI: InChI=1S/C18H13BrClNO/c1-10-7-11(2)17-14(8-10)15(18(20)22)9-16(21-17)12-3-5-13(19)6-4-12/h3-9H,1-2H3

InChI key: InChIKey=FBKMJCZHWHWKJY-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(Br)C=C3)C(C)=CC(C)=C2

Synonyms:

• 2-(4-Bromophenyl)-6,8-dimethyl-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(4-bromophenyl)-6,8-dimethyl-