CAS 1160262-81-6

2-(2-Methoxyphenyl)-6,8-dimethyl-4-quinolinecarbonyl chloride

Description:

2-(2-Methoxyphenyl)-6,8-dimethyl-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline ring system substituted with a methoxyphenyl group and additional methyl groups. This compound features a carbonyl chloride functional group, which makes it reactive, particularly in nucleophilic substitution reactions. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The quinoline moiety is known for its pharmacological properties, including antimicrobial and antimalarial activities. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, its reactivity as an acyl chloride allows for further derivatization, making it a valuable intermediate in organic synthesis. Overall, this compound exemplifies the intersection of structural complexity and reactivity, which is often explored in the design of novel chemical entities.

Formula: C₁₉H₁₆ClNO₂

InChI: InChI=1S/C19H16ClNO2/c1-11-8-12(2)18-14(9-11)15(19(20)22)10-16(21-18)13-6-4-5-7-17(13)23-3/h4-10H,1-3H3

InChI key: InChIKey=AWQZXFYNHCSZJK-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(OC)C=CC=C3)C(C)=CC(C)=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(2-methoxyphenyl)-6,8-dimethyl-
• 2-(2-Methoxyphenyl)-6,8-dimethyl-4-quinolinecarbonyl chloride