CAS 1160262-95-2

6,8-Dimethyl-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride

Description:

6,8-Dimethyl-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline ring system, carbonyl chloride functional group, and propoxyphenyl substituent. This compound typically exhibits properties associated with halogenated carbonyl compounds, such as reactivity towards nucleophiles due to the presence of the carbonyl chloride group, which can undergo hydrolysis to form the corresponding acid. The presence of the dimethyl and propoxy groups contributes to its lipophilicity, potentially influencing its solubility in organic solvents and biological membranes. Additionally, the quinoline moiety may impart biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Safety and handling precautions are essential due to the reactive nature of the carbonyl chloride functional group, which can release hydrochloric acid upon hydrolysis.

Formula: C₂₁H₂₀ClNO₂

InChI: InChI=1S/C21H20ClNO2/c1-4-8-25-16-7-5-6-15(11-16)19-12-18(21(22)24)17-10-13(2)9-14(3)20(17)23-19/h5-7,9-12H,4,8H2,1-3H3

InChI key: InChIKey=QNRLYXFYXQPCBI-UHFFFAOYSA-N

SMILES: CC=1C2=C(C(C(Cl)=O)=CC(=N2)C3=CC(OCCC)=CC=C3)C=C(C)C1

Synonyms:

• 6,8-Dimethyl-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 6,8-dimethyl-2-(3-propoxyphenyl)-
• 6,8-dimethyl-2-(3-propoxyphenyl)quinoline-4-carbonyl chloride
• 4-quinolinecarbonyl chloride, 6,8-dimethyl-2-(3-propoxyphe