CAS 1160263-02-4

2-(1,3-Benzodioxol-5-yl)-6,8-dimethyl-4-quinolinecarbonyl chloride

Description:

2-(1,3-Benzodioxol-5-yl)-6,8-dimethyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a benzodioxole group. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, particularly acylation. The presence of multiple methyl groups contributes to its hydrophobic nature, influencing its solubility and reactivity. The benzodioxole fragment is known for its potential biological activity, often associated with compounds that exhibit pharmacological properties. As a chlorinated compound, it may also serve as an intermediate in the synthesis of more complex molecules in medicinal chemistry. Its specific applications and biological activities would depend on further studies, but compounds of this nature are often explored for their potential in drug development and as building blocks in organic synthesis. Safety precautions should be observed when handling this compound due to its reactive nature.

Formula: C₁₉H₁₄ClNO₃

InChI: InChI=1S/C19H14ClNO3/c1-10-5-11(2)18-13(6-10)14(19(20)22)8-15(21-18)12-3-4-16-17(7-12)24-9-23-16/h3-8H,9H2,1-2H3

InChI key: InChIKey=CQVTZUHEUNFVID-UHFFFAOYSA-N

SMILES: CC=1C2=C(C(C(Cl)=O)=CC(=N2)C=3C=C4C(=CC3)OCO4)C=C(C)C1

Synonyms:

• 2-(1,3-Benzodioxol-5-yl)-6,8-dimethyl-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(1,3-benzodioxol-5-yl)-6,8-dimethyl-