CAS 1160263-05-7
:6-Chloro-2-(2,5-dimethyl-3-thienyl)-4-quinolinecarbonyl chloride
Description:
6-Chloro-2-(2,5-dimethyl-3-thienyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core and a thienyl substituent. The presence of a chloro group and a carbonyl chloride functional group contributes to its reactivity, making it a potential intermediate in various chemical syntheses. This compound is likely to exhibit properties typical of halogenated organic compounds, such as increased lipophilicity and potential biological activity. Its thienyl group may impart unique electronic properties, influencing its interactions in biological systems or with other chemical entities. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both heterocyclic rings and reactive functional groups. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from literature for practical applications. Safety and handling precautions should be observed due to the presence of reactive chlorine and potential toxicity associated with similar compounds.
Formula:C16H11Cl2NOS
InChI:InChI=1S/C16H11Cl2NOS/c1-8-5-11(9(2)21-8)15-7-13(16(18)20)12-6-10(17)3-4-14(12)19-15/h3-7H,1-2H3
InChI key:InChIKey=PRRANPSNDKJSMW-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(C)SC(C)=C3)C=CC(Cl)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 6-chloro-2-(2,5-dimethyl-3-thienyl)-
- 6-Chloro-2-(2,5-dimethyl-3-thienyl)-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.