CAS 1160263-06-8

6-Chloro-2-(2-thienyl)-4-quinolinecarbonyl chloride

Description:

6-Chloro-2-(2-thienyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline ring system, a thienyl group, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of the chlorine atom and the carbonyl chloride moiety, which can participate in nucleophilic substitution reactions. The thienyl group contributes to its aromatic character and may influence its solubility and interaction with biological targets. As a carbonyl chloride, it is likely to be sensitive to moisture and can release hydrochloric acid upon hydrolysis. This compound may find applications in medicinal chemistry or as an intermediate in the synthesis of more complex molecules. Its specific reactivity and biological activity would depend on the context of its use and the presence of other functional groups in a given reaction or application. Safety precautions should be observed when handling this compound due to its potential hazards associated with chlorinated organic substances.

Formula: C₁₄H₇Cl₂NOS

InChI: InChI=1S/C14H7Cl2NOS/c15-8-3-4-11-9(6-8)10(14(16)18)7-12(17-11)13-2-1-5-19-13/h1-7H

InChI key: InChIKey=NLYIGYOCUWDUDQ-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=CS3)C=CC(Cl)=C2

Synonyms:

• 6-Chloro-2-(2-thienyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 6-chloro-2-(2-thienyl)-