CAS 1160263-07-9: 6-Chloro-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride
Description:6-Chloro-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core, a chloro substituent, and a thienyl group. The presence of the chloro group suggests potential reactivity, particularly in nucleophilic substitution reactions. The thienyl moiety, derived from thiophene, contributes to the compound's aromatic character and may influence its electronic properties and biological activity. This compound is likely to be a solid at room temperature, exhibiting moderate solubility in organic solvents due to its aromatic nature. Its carbonyl chloride functional group indicates that it can act as an acylating agent, making it useful in various synthetic applications, including the preparation of more complex molecules. The compound's unique structure may also confer specific pharmacological properties, making it of interest in medicinal chemistry. However, handling precautions should be observed due to the potential reactivity of the carbonyl chloride group and the presence of chlorine.
Formula:C15H9Cl2NOS
InChI:InChI=1S/C15H9Cl2NOS/c1-8-2-5-14(20-8)13-7-11(15(17)19)10-6-9(16)3-4-12(10)18-13/h2-7H,1H3
InChI key:InChIKey=LULIYVJIYIDAIV-UHFFFAOYSA-N
SMILES:O=C(Cl)C=1C=C(N=C2C=CC(Cl)=CC21)C=3SC(=CC3)C
- Synonyms:
- 6-Chloro-2-(5-methyl-2-thienyl)-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 6-chloro-2-(5-methyl-2-thienyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 6-chloro-2-(5-methyl-2-thienyl)quinoline-4-carbonyl chloride REF: 10-F368495CAS: 1160263-07-9 | - - - | - - - | Discontinued product |
![]() | 6-Chloro-2-(5-methyl-2-thienyl)quinoline-4-carbonyl chloride REF: 3D-FC120818CAS: 1160263-07-9 | Min. 95% | - - - | Discontinued product |

6-chloro-2-(5-methyl-2-thienyl)quinoline-4-carbonyl chloride
Ref: 10-F368495
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |

6-Chloro-2-(5-methyl-2-thienyl)quinoline-4-carbonyl chloride
Ref: 3D-FC120818
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |