CAS 1160263-10-4
:6-Chloro-2-(5-chloro-2-thienyl)-4-quinolinecarbonyl chloride
Description:
6-Chloro-2-(5-chloro-2-thienyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core, a thienyl group, and a carbonyl chloride functional group. The presence of chlorine atoms in both the quinoline and thienyl moieties contributes to its reactivity and potential biological activity. This compound is likely to exhibit properties typical of halogenated organic compounds, such as increased lipophilicity and potential for interaction with biological targets. The carbonyl chloride functional group suggests that it may participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the thienyl group may impart unique electronic properties, influencing the compound's behavior in various chemical environments. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C14H6Cl3NOS
InChI:InChI=1S/C14H6Cl3NOS/c15-7-1-2-10-8(5-7)9(14(17)19)6-11(18-10)12-3-4-13(16)20-12/h1-6H
InChI key:InChIKey=PTQHWHIDSJWFCL-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(Cl)S3)C=CC(Cl)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 6-chloro-2-(5-chloro-2-thienyl)-
- 6-Chloro-2-(5-chloro-2-thienyl)-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.