CAS 1160263-11-5

6-Chloro-2-(2-methylphenyl)-4-quinolinecarbonyl chloride

Description:

6-Chloro-2-(2-methylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features a chloro substituent at the 6-position and a carbonyl chloride functional group, indicating it is an acyl chloride, which is reactive and can participate in various chemical reactions, particularly acylation. The presence of the 2-methylphenyl group enhances its lipophilicity, potentially influencing its biological activity and solubility properties. As an acyl chloride, it is likely to be sensitive to moisture and can hydrolyze to form the corresponding carboxylic acid. This compound may be of interest in medicinal chemistry and organic synthesis, where it could serve as an intermediate in the preparation of more complex molecules. Safety precautions should be taken when handling this substance due to its reactive nature and potential toxicity.

Formula: C₁₇H₁₁Cl₂NO

InChI: InChI=1S/C17H11Cl2NO/c1-10-4-2-3-5-12(10)16-9-14(17(19)21)13-8-11(18)6-7-15(13)20-16/h2-9H,1H3

InChI key: InChIKey=WXPOXEMXACXSSH-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(C)C=CC=C3)C=CC(Cl)=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 6-chloro-2-(2-methylphenyl)-
• 6-Chloro-2-(2-methylphenyl)-4-quinolinecarbonyl chloride