CymitQuimica logo

CAS 1160263-13-7

:

6-Chloro-2-(2,4-dimethylphenyl)-4-quinolinecarbonyl chloride

Description:
6-Chloro-2-(2,4-dimethylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a chloro substituent. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, particularly acylation. The presence of the 2,4-dimethylphenyl group contributes to its hydrophobic characteristics, influencing its solubility and reactivity in organic solvents. The chloro group enhances its electrophilic nature, allowing it to react with nucleophiles. This compound is of interest in medicinal chemistry and organic synthesis, where it may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its specific reactivity and properties can be influenced by the steric and electronic effects of the substituents on the quinoline ring and the phenyl group. Safety precautions should be taken when handling this compound due to its potential reactivity and toxicity associated with acyl chlorides.
Formula:C18H13Cl2NO
InChI:InChI=1S/C18H13Cl2NO/c1-10-3-5-13(11(2)7-10)17-9-15(18(20)22)14-8-12(19)4-6-16(14)21-17/h3-9H,1-2H3
InChI key:InChIKey=JLINWWFIUILGMK-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(C)C=C(C)C=C3)C=CC(Cl)=C2
Synonyms:
  • 6-Chloro-2-(2,4-dimethylphenyl)-4-quinolinecarbonyl chloride
  • 4-Quinolinecarbonyl chloride, 6-chloro-2-(2,4-dimethylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.