CAS 1160263-15-9
:6-Chloro-2-(2,5-dimethylphenyl)-4-quinolinecarbonyl chloride
Description:
6-Chloro-2-(2,5-dimethylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety and a chloro substituent. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, particularly acylation. The presence of the 2,5-dimethylphenyl group contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity in organic solvents. The chloro group can enhance electrophilicity, making it useful in synthetic organic chemistry for the introduction of acyl groups into other molecules. Additionally, the quinoline structure is known for its biological activity, which may suggest potential applications in pharmaceuticals or agrochemicals. Overall, this compound's reactivity, structural features, and potential applications make it of interest in both research and industrial contexts. However, safety precautions should be observed due to the presence of reactive functional groups.
Formula:C18H13Cl2NO
InChI:InChI=1S/C18H13Cl2NO/c1-10-3-4-11(2)13(7-10)17-9-15(18(20)22)14-8-12(19)5-6-16(14)21-17/h3-9H,1-2H3
InChI key:InChIKey=LWZACAPKZLDXKI-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(C)C=CC(C)=C3)C=CC(Cl)=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 6-chloro-2-(2,5-dimethylphenyl)-
- 6-Chloro-2-(2,5-dimethylphenyl)-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.