CAS 1160263-16-0

6-Chloro-2-(4-ethylphenyl)-4-quinolinecarbonyl chloride

Description:

6-Chloro-2-(4-ethylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This substance features a chloro substituent at the 6-position and an ethylphenyl group at the 2-position, contributing to its unique reactivity and potential applications in organic synthesis. The carbonyl chloride functional group indicates that it can act as an acylating agent, making it useful in various chemical reactions, particularly in the synthesis of more complex molecules. The presence of the chloro group enhances its electrophilic character, allowing it to participate in nucleophilic substitution reactions. This compound may be of interest in medicinal chemistry and material science due to its structural features, which can influence biological activity and physical properties. As with many chlorinated compounds, appropriate safety measures should be taken when handling it, as it may pose health and environmental risks.

Formula: C₁₈H₁₃Cl₂NO

InChI: InChI=1S/C18H13Cl2NO/c1-2-11-3-5-12(6-4-11)17-10-15(18(20)22)14-9-13(19)7-8-16(14)21-17/h3-10H,2H2,1H3

InChI key: InChIKey=ZXZJPBYPBCUOAG-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(CC)C=C3)C=CC(Cl)=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 6-chloro-2-(4-ethylphenyl)-
• 6-Chloro-2-(4-ethylphenyl)-4-quinolinecarbonyl chloride