CAS 1160263-17-1
:6-Chloro-2-(4-propylphenyl)-4-quinolinecarbonyl chloride
Description:
6-Chloro-2-(4-propylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro substituent at the 6-position and a propylphenyl group at the 2-position, contributing to its unique chemical properties. The presence of the carbonyl chloride functional group indicates that it is an acyl chloride, which is typically reactive and can participate in various chemical reactions, such as nucleophilic acyl substitution. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in synthesizing other complex organic molecules. As with many chlorinated compounds, it may also have implications for environmental and health safety, necessitating careful handling and disposal. Overall, the characteristics of this compound make it a subject of interest in both synthetic organic chemistry and pharmacological research.
Formula:C19H15Cl2NO
InChI:InChI=1S/C19H15Cl2NO/c1-2-3-12-4-6-13(7-5-12)18-11-16(19(21)23)15-10-14(20)8-9-17(15)22-18/h4-11H,2-3H2,1H3
InChI key:InChIKey=PCWMJNSQLYAXCO-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(CCC)C=C3)C=CC(Cl)=C2
Synonyms:- 6-Chloro-2-(4-propylphenyl)-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 6-chloro-2-(4-propylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.