CAS 1160263-18-2
:6-Chloro-2-[4-(1-methylethyl)phenyl]-4-quinolinecarbonyl chloride
Description:
6-Chloro-2-[4-(1-methylethyl)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a chloro substituent. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, such as acylation. The presence of the isopropyl group (1-methylethyl) on the phenyl ring contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity in organic solvents. The chloro substituent may also enhance its reactivity, allowing for further derivatization. This compound is likely to be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing other chemical entities. As with many chlorinated compounds, it is essential to handle it with care, considering its potential toxicity and environmental impact. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C19H15Cl2NO
InChI:InChI=1S/C19H15Cl2NO/c1-11(2)12-3-5-13(6-4-12)18-10-16(19(21)23)15-9-14(20)7-8-17(15)22-18/h3-11H,1-2H3
InChI key:InChIKey=KHLCQVJLGGFRGQ-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(C(C)C)C=C3)C=CC(Cl)=C2
Synonyms:- 6-Chloro-2-[4-(1-methylethyl)phenyl]-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 6-chloro-2-[4-(1-methylethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.