CAS 1160263-20-6

6-Chloro-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarbonyl chloride

Description:

6-Chloro-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety, a chloro substituent, and a carbonyl chloride functional group. This compound features a chloro group at the 6-position of the quinoline ring, which can influence its reactivity and potential applications in medicinal chemistry. The presence of the 4-(2-methylpropyl)phenyl group enhances its lipophilicity, potentially affecting its biological activity and solubility in organic solvents. As a carbonyl chloride, it is likely to be reactive, particularly towards nucleophiles, making it useful in various chemical synthesis processes. The compound may exhibit interesting pharmacological properties, which could be explored in drug development. However, due to the presence of chlorine and the carbonyl chloride functionality, it may also pose certain hazards, necessitating careful handling and storage. Overall, this compound's unique structural features suggest potential utility in various chemical and pharmaceutical applications.

Formula: C₂₀H₁₇Cl₂NO

InChI: InChI=1S/C20H17Cl2NO/c1-12(2)9-13-3-5-14(6-4-13)19-11-17(20(22)24)16-10-15(21)7-8-18(16)23-19/h3-8,10-12H,9H2,1-2H3

InChI key: InChIKey=FKJRMZAHGRLENV-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(CC(C)C)C=C3)C=CC(Cl)=C2

Synonyms:

• 6-Chloro-2-[4-(2-methylpropyl)phenyl]-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 6-chloro-2-[4-(2-methylpropyl)phenyl]-