CAS 1160263-29-5

6-Chloro-2-(2-methoxyphenyl)-4-quinolinecarbonyl chloride

Description:

6-Chloro-2-(2-methoxyphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline ring system, a chloro substituent, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as moderate to high reactivity due to the presence of the carbonyl chloride group, which can participate in nucleophilic substitution reactions. The methoxyphenyl group contributes to its potential solubility in organic solvents and may influence its biological activity. The chloro substituent can enhance the compound's lipophilicity, affecting its interaction with biological membranes. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization. Its potential applications could span across pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific uses would depend on further research into its biological properties and reactivity.

Formula: C₁₇H₁₁Cl₂NO₂

InChI: InChI=1S/C17H11Cl2NO2/c1-22-16-5-3-2-4-11(16)15-9-13(17(19)21)12-8-10(18)6-7-14(12)20-15/h2-9H,1H3

InChI key: InChIKey=KJYQQONTDOZVII-UHFFFAOYSA-N

SMILES: O(C)C1=C(C2=NC3=C(C(C(Cl)=O)=C2)C=C(Cl)C=C3)C=CC=C1

Synonyms:

• 6-Chloro-2-(2-methoxyphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 6-chloro-2-(2-methoxyphenyl)-