CAS 1160263-30-8

6-Chloro-2-(3-methoxyphenyl)-4-quinolinecarbonyl chloride

Description:

6-Chloro-2-(3-methoxyphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro group at the 6-position and a methoxyphenyl group at the 2-position, contributing to its unique reactivity and potential biological activity. The carbonyl chloride functional group indicates that it can act as an acylating agent, making it useful in various synthetic applications, particularly in medicinal chemistry for the development of pharmaceuticals. The presence of the methoxy group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. This compound may exhibit interesting biological activities due to its structural features, which could be explored in drug discovery. As with many chlorinated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this substance in a laboratory setting.

Formula: C₁₇H₁₁Cl₂NO₂

InChI: InChI=1S/C17H11Cl2NO2/c1-22-12-4-2-3-10(7-12)16-9-14(17(19)21)13-8-11(18)5-6-15(13)20-16/h2-9H,1H3

InChI key: InChIKey=IGDQKZGYHRVTCG-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OC)=CC=C3)C=CC(Cl)=C2

Synonyms:

• 6-Chloro-2-(3-methoxyphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 6-chloro-2-(3-methoxyphenyl)-