CymitQuimica logo

CAS 1160263-40-0

:

2-(4-Butoxyphenyl)-6-chloro-4-quinolinecarbonyl chloride

Description:
2-(4-Butoxyphenyl)-6-chloro-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety, a butoxyphenyl group, and a carbonyl chloride functional group. This compound typically exhibits properties associated with both aromatic and halogenated compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl chloride group, which can participate in nucleophilic substitution reactions. The chloro substituent may influence its biological activity and reactivity, making it of interest in medicinal chemistry and material science. Additionally, the butoxy group can enhance lipophilicity, potentially affecting the compound's pharmacokinetics and interactions with biological systems. As with many chlorinated compounds, safety precautions should be taken due to potential toxicity and environmental concerns. Overall, this compound's unique structural features suggest it may have applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C20H17Cl2NO2
InChI:InChI=1S/C20H17Cl2NO2/c1-2-3-10-25-15-7-4-13(5-8-15)19-12-17(20(22)24)16-11-14(21)6-9-18(16)23-19/h4-9,11-12H,2-3,10H2,1H3
InChI key:InChIKey=RKZSWSOTBXPYAV-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCCCC)C=C3)C=CC(Cl)=C2
Synonyms:
  • 4-Quinolinecarbonyl chloride, 2-(4-butoxyphenyl)-6-chloro-
  • 2-(4-Butoxyphenyl)-6-chloro-4-quinolinecarbonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.