CymitQuimica logo

CAS 1160263-41-1

:

6-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride

Description:
6-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline ring system, a chloro substituent, and a carbonyl chloride functional group. This compound features a phenyl group substituted with a 2-methylpropoxy group, contributing to its hydrophobic properties. The presence of the carbonyl chloride functional group indicates that it can participate in nucleophilic substitution reactions, making it a potential intermediate in organic synthesis. The chloro substituent enhances its reactivity, allowing for further derivatization. This compound may exhibit biological activity, which could be of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its solubility and stability in various solvents can vary, influencing its application in chemical reactions and formulations. As with many chlorinated compounds, appropriate safety measures should be taken due to potential toxicity and environmental concerns. Overall, this compound represents a versatile building block in medicinal chemistry and materials science.
Formula:C20H17Cl2NO2
InChI:InChI=1S/C20H17Cl2NO2/c1-12(2)11-25-15-6-3-13(4-7-15)19-10-17(20(22)24)16-9-14(21)5-8-18(16)23-19/h3-10,12H,11H2,1-2H3
InChI key:InChIKey=UVZHBTYMZLYRAU-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCC(C)C)C=C3)C=CC(Cl)=C2
Synonyms:
  • 6-Chloro-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride
  • 4-Quinolinecarbonyl chloride, 6-chloro-2-[4-(2-methylpropoxy)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.