CymitQuimica logo

CAS 1160263-44-4

:

2-(3-Butoxyphenyl)-6-chloro-4-quinolinecarbonyl chloride

Description:
2-(3-Butoxyphenyl)-6-chloro-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety, a chloro substituent, and a butoxyphenyl group. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, such as acylation and nucleophilic substitution. The presence of the chloro group enhances its reactivity, while the butoxyphenyl group contributes to its hydrophobic characteristics. This compound may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or agrochemicals. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many chlorinated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C20H17Cl2NO2
InChI:InChI=1S/C20H17Cl2NO2/c1-2-3-9-25-15-6-4-5-13(10-15)19-12-17(20(22)24)16-11-14(21)7-8-18(16)23-19/h4-8,10-12H,2-3,9H2,1H3
InChI key:InChIKey=QEYISGJRPHISOI-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCCCC)=CC=C3)C=CC(Cl)=C2
Synonyms:
  • 4-Quinolinecarbonyl chloride, 2-(3-butoxyphenyl)-6-chloro-
  • 2-(3-Butoxyphenyl)-6-chloro-4-quinolinecarbonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.