CAS 1160263-45-5

6-Chloro-2-[3-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride

Description:

6-Chloro-2-[3-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a chloro substituent. This compound features a carbonyl chloride functional group, indicating it is likely reactive, particularly towards nucleophiles. The presence of the 2-methylpropoxy group suggests it has moderate lipophilicity, which may influence its solubility and biological activity. The quinoline ring system is known for its diverse pharmacological properties, including antimicrobial and antitumor activities. The chlorine atom contributes to the compound's reactivity and may enhance its biological interactions. Overall, this compound's unique structural features make it of interest in medicinal chemistry and drug development, although specific applications would depend on further research into its biological activity and safety profile. As with many synthetic compounds, handling precautions should be observed due to potential toxicity and reactivity associated with the carbonyl chloride functional group.

Formula: C₂₀H₁₇Cl₂NO₂

InChI: InChI=1S/C20H17Cl2NO2/c1-12(2)11-25-15-5-3-4-13(8-15)19-10-17(20(22)24)16-9-14(21)6-7-18(16)23-19/h3-10,12H,11H2,1-2H3

InChI key: InChIKey=OYWWRADBYDFBSX-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCC(C)C)=CC=C3)C=CC(Cl)=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 6-chloro-2-[3-(2-methylpropoxy)phenyl]-
• 6-Chloro-2-[3-(2-methylpropoxy)phenyl]-4-quinolinecarbonyl chloride