CAS 1160263-55-7

8-Chloro-2-(2-methylphenyl)-4-quinolinecarbonyl chloride

Description:

8-Chloro-2-(2-methylphenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a quinoline moiety substituted with a chloro group and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of the chlorine atom. The carbonyl chloride functional group suggests that it can participate in acylation reactions, making it useful in organic synthesis. The presence of the 2-methylphenyl group adds to its hydrophobic character, which may influence its solubility in organic solvents. Additionally, compounds of this nature may exhibit biological activity, potentially serving as intermediates in the synthesis of pharmaceuticals or agrochemicals. Safety considerations are important, as carbonyl chlorides can be hazardous, necessitating proper handling and storage protocols. Overall, this compound's structural features and functional groups contribute to its reactivity and potential applications in various chemical processes.

Formula: C₁₇H₁₁Cl₂NO

InChI: InChI=1S/C17H11Cl2NO/c1-10-5-2-3-6-11(10)15-9-13(17(19)21)12-7-4-8-14(18)16(12)20-15/h2-9H,1H3

InChI key: InChIKey=CVSWKJIUGVPIFA-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(C)C=CC=C3)C(Cl)=CC=C2

Synonyms:

• 8-Chloro-2-(2-methylphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 8-chloro-2-(2-methylphenyl)-