CAS 1160263-56-8

7-Chloro-8-methyl-2-(2-methylphenyl)-4-quinolinecarbonyl chloride

Description:

7-Chloro-8-methyl-2-(2-methylphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This compound features a chloro substituent at the 7-position and a methyl group at the 8-position of the quinoline ring, contributing to its unique reactivity and potential biological activity. The presence of the carbonyl chloride functional group indicates that it can participate in acylation reactions, making it useful in organic synthesis. The additional 2-methylphenyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. This compound may exhibit various biological activities, which could be explored in medicinal chemistry. Its specific applications and effects would depend on further research and characterization, including studies on its solubility, stability, and interaction with biological targets. As with many synthetic compounds, safety and handling precautions are essential due to the presence of reactive functional groups.

Formula: C₁₈H₁₃Cl₂NO

InChI: InChI=1S/C18H13Cl2NO/c1-10-5-3-4-6-12(10)16-9-14(18(20)22)13-7-8-15(19)11(2)17(13)21-16/h3-9H,1-2H3

InChI key: InChIKey=YKNAOUDIBCYZLA-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(C)C=CC=C3)C(C)=C(Cl)C=C2

Synonyms:

• 7-Chloro-8-methyl-2-(2-methylphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 7-chloro-8-methyl-2-(2-methylphenyl)-