CAS 1160263-59-1

8-Chloro-2-(2-chlorophenyl)-4-quinolinecarbonyl chloride

Description:

8-Chloro-2-(2-chlorophenyl)-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety and multiple chlorine substituents. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of chlorine atoms, which can participate in nucleophilic substitution reactions. The quinoline structure contributes to its potential biological activity, as many quinoline derivatives are known for their pharmacological properties. The carbonyl chloride functional group indicates that this compound can act as an acylating agent, making it useful in organic synthesis. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. Safety considerations are important when handling this compound, as it may pose risks due to its reactivity and potential toxicity. Overall, 8-Chloro-2-(2-chlorophenyl)-4-quinolinecarbonyl chloride is of interest in both synthetic chemistry and medicinal chemistry research.

Formula: C₁₆H₈Cl₃NO

InChI: InChI=1S/C16H8Cl3NO/c17-12-6-2-1-4-10(12)14-8-11(16(19)21)9-5-3-7-13(18)15(9)20-14/h1-8H

InChI key: InChIKey=PLPRQGVAXSEWLF-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(Cl)C=CC=C3)C(Cl)=CC=C2

Synonyms:

• 8-Chloro-2-(2-chlorophenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 8-chloro-2-(2-chlorophenyl)-