CAS 1160263-60-4

7-Chloro-2-(2-chlorophenyl)-8-methyl-4-quinolinecarbonyl chloride

Description:

7-Chloro-2-(2-chlorophenyl)-8-methyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with chlorine and methyl groups. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, particularly acylation. The presence of chlorine atoms enhances its reactivity and may influence its biological activity, potentially making it of interest in medicinal chemistry. The quinoline moiety is known for its pharmacological properties, including antimicrobial and antimalarial activities. Additionally, the compound's solubility and stability can be affected by the presence of the chlorophenyl and methyl substituents. As with many chlorinated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns. Overall, this compound's unique structural features suggest potential applications in drug development and chemical synthesis, warranting further investigation into its properties and reactivity.

Formula: C₁₇H₁₀Cl₃NO

InChI: InChI=1S/C17H10Cl3NO/c1-9-13(18)7-6-10-12(17(20)22)8-15(21-16(9)10)11-4-2-3-5-14(11)19/h2-8H,1H3

InChI key: InChIKey=UDNBBVBUUMWVLH-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(Cl)C=CC=C3)C(C)=C(Cl)C=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 7-chloro-2-(2-chlorophenyl)-8-methyl-
• 7-Chloro-2-(2-chlorophenyl)-8-methyl-4-quinolinecarbonyl chloride