CAS 1160263-62-6

2-(4-Bromophenyl)-7-chloro-8-methyl-4-quinolinecarbonyl chloride

Description:

2-(4-Bromophenyl)-7-chloro-8-methyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with various functional groups. The presence of a bromophenyl group and a chloro substituent contributes to its potential reactivity and biological activity. This compound is typically used in medicinal chemistry and may exhibit properties such as antimicrobial or anticancer activity, although specific biological effects would depend on further studies. The carbonyl chloride functional group indicates that it can participate in acylation reactions, making it a useful intermediate in organic synthesis. Its molecular structure suggests that it may have moderate to high lipophilicity, influencing its solubility and permeability in biological systems. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, this compound represents a class of quinoline derivatives that are of interest in pharmaceutical research and development.

Formula: C₁₇H₁₀BrCl₂NO

InChI: InChI=1S/C17H10BrCl2NO/c1-9-14(19)7-6-12-13(17(20)22)8-15(21-16(9)12)10-2-4-11(18)5-3-10/h2-8H,1H3

InChI key: InChIKey=UMXFDUWIHQMFNI-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(Br)C=C3)C(C)=C(Cl)C=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 2-(4-bromophenyl)-7-chloro-8-methyl-
• 2-(4-Bromophenyl)-7-chloro-8-methyl-4-quinolinecarbonyl chloride