CAS 1160263-63-7

2-(3-Bromophenyl)-8-chloro-4-quinolinecarbonyl chloride

Description:

2-(3-Bromophenyl)-8-chloro-4-quinolinecarbonyl chloride is a chemical compound characterized by its complex structure, which includes a quinoline moiety, a bromophenyl group, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of chlorine and bromine atoms. The quinoline structure contributes to its potential biological activity, as quinolines are known for their roles in pharmaceuticals and agrochemicals. The carbonyl chloride group indicates that it can participate in acylation reactions, making it useful in synthetic organic chemistry. Additionally, the presence of halogens may influence its solubility, stability, and interaction with biological targets. Overall, this compound's unique combination of functional groups suggests potential applications in medicinal chemistry and materials science, although specific reactivity and biological activity would depend on further empirical studies.

Formula: C₁₆H₈BrCl₂NO

InChI: InChI=1S/C16H8BrCl2NO/c17-10-4-1-3-9(7-10)14-8-12(16(19)21)11-5-2-6-13(18)15(11)20-14/h1-8H

InChI key: InChIKey=FFBOLGHGJWTLGI-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(Br)=CC=C3)C(Cl)=CC=C2

Synonyms:

• 2-(3-Bromophenyl)-8-chloro-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 2-(3-bromophenyl)-8-chloro-