CAS 1160263-64-8
:2-(3-Bromophenyl)-7-chloro-8-methyl-4-quinolinecarbonyl chloride
Description:
2-(3-Bromophenyl)-7-chloro-8-methyl-4-quinolinecarbonyl chloride, identified by its CAS number 1160263-64-8, is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety. This compound features a bromophenyl group and a chloro substituent, contributing to its unique chemical properties. The presence of the carbonyl chloride functional group indicates that it can participate in acylation reactions, making it a potential intermediate in organic synthesis. Its molecular structure suggests that it may exhibit biological activity, possibly as a pharmaceutical agent or a precursor in drug development. The compound's reactivity is influenced by the electron-withdrawing effects of the bromine and chlorine atoms, which can affect its stability and interactions with other molecules. Additionally, the presence of the methyl group may influence its solubility and lipophilicity. Overall, this compound's characteristics make it of interest in both synthetic chemistry and medicinal chemistry research.
Formula:C17H10BrCl2NO
InChI:InChI=1S/C17H10BrCl2NO/c1-9-14(19)6-5-12-13(17(20)22)8-15(21-16(9)12)10-3-2-4-11(18)7-10/h2-8H,1H3
InChI key:InChIKey=GBPZWRUOADBDKQ-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(Br)=CC=C3)C(C)=C(Cl)C=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 2-(3-bromophenyl)-7-chloro-8-methyl-
- 2-(3-Bromophenyl)-7-chloro-8-methyl-4-quinolinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.