CAS 1160263-66-0

7-Chloro-2-(4-methoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride

Description:

7-Chloro-2-(4-methoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with a chloro group, a methoxyphenyl group, and a carbonyl chloride functional group. This compound typically exhibits properties associated with quinoline derivatives, such as potential biological activity, including antimicrobial or antitumor effects, due to the presence of the quinoline moiety. The carbonyl chloride functional group suggests reactivity, particularly in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. The methoxy group can influence the compound's solubility and reactivity, while the chloro substituent may enhance its electrophilic character. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and material science, although specific biological activities and physical properties would require empirical investigation for detailed characterization.

Formula: C₁₈H₁₃Cl₂NO₂

InChI: InChI=1S/C18H13Cl2NO2/c1-10-15(19)8-7-13-14(18(20)22)9-16(21-17(10)13)11-3-5-12(23-2)6-4-11/h3-9H,1-2H3

InChI key: InChIKey=JEOHKLKOKMKHFI-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OC)C=C3)C(C)=C(Cl)C=C2

Synonyms:

• 7-Chloro-2-(4-methoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 7-chloro-2-(4-methoxyphenyl)-8-methyl-