CymitQuimica logo

CAS 1160263-72-8

:

7-Chloro-2-(4-ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride

Description:
7-Chloro-2-(4-ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with various functional groups. The presence of a chloro group at the 7-position and an ethoxyphenyl group at the 2-position contributes to its unique reactivity and potential biological activity. The carbonyl chloride functional group indicates that it can participate in acylation reactions, making it useful in organic synthesis. This compound may exhibit properties typical of quinoline derivatives, such as antimicrobial or antimalarial activity, although specific biological data would be necessary to confirm such effects. Its molecular structure suggests it could be a candidate for further research in medicinal chemistry, particularly in the development of new pharmaceuticals. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity associated with the chloro and carbonyl chloride functionalities.
Formula:C19H15Cl2NO2
InChI:InChI=1S/C19H15Cl2NO2/c1-3-24-13-6-4-12(5-7-13)17-10-15(19(21)23)14-8-9-16(20)11(2)18(14)22-17/h4-10H,3H2,1-2H3
InChI key:InChIKey=DVEKRGVIPNRBGB-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCC)C=C3)C(C)=C(Cl)C=C2
Synonyms:
  • 4-Quinolinecarbonyl chloride, 7-chloro-2-(4-ethoxyphenyl)-8-methyl-
  • 7-Chloro-2-(4-ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.