CAS 1160263-73-9: 8-Chloro-2-(3-ethoxyphenyl)-4-quinolinecarbonyl chloride

Description: 8-Chloro-2-(3-ethoxyphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety, a chloro substituent, and an ethoxyphenyl group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. The quinoline ring contributes to its potential biological activity, as many quinoline derivatives are known for their pharmacological properties, including antimicrobial and antimalarial effects. The ethoxyphenyl group may enhance lipophilicity, influencing the compound's solubility and permeability in biological systems. Additionally, the carbonyl chloride functional group indicates that it can act as an acylating agent, making it useful in various synthetic applications. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry and organic synthesis, although specific applications would depend on further research and characterization.

Formula: C₁₈H₁₃Cl₂NO₂

InChI: InChI=1S/C18H13Cl2NO2/c1-2-23-12-6-3-5-11(9-12)16-10-14(18(20)22)13-7-4-8-15(19)17(13)21-16/h3-10H,2H2,1H3

InChI key: InChIKey=QDPBIISCSWVAHL-UHFFFAOYSA-N

SMILES: O=C(Cl)C=1C=C(N=C2C(Cl)=CC=CC21)C=3C=CC=C(OCC)C3

Synonyms:

• 8-Chloro-2-(3-ethoxyphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 8-chloro-2-(3-ethoxyphenyl)-

8-chloro-2-(3-ethoxyphenyl)quinoline-4-carbonyl chloride

CAS: 1160263-73-9

• Molecular weight: 346.2099914550781

8-Chloro-2-(3-ethoxyphenyl)quinoline-4-carbonyl chloride

CAS: 1160263-73-9

Please enquire for more information about 8-Chloro-2-(3-ethoxyphenyl)quinoline-4-carbonyl chloride including the price, delivery time and more …

• Formula: C₁₈H₁₃Cl₂NO₂
• Purity: Min. 95%
• Molecular weight: 346.21 g/mol