CAS 1160263-73-9
:8-Chloro-2-(3-ethoxyphenyl)-4-quinolinecarbonyl chloride
Description:
8-Chloro-2-(3-ethoxyphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety, a chloro substituent, and an ethoxyphenyl group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. The quinoline ring contributes to its potential biological activity, as many quinoline derivatives are known for their pharmacological properties, including antimicrobial and antimalarial effects. The ethoxyphenyl group may enhance lipophilicity, influencing the compound's solubility and permeability in biological systems. Additionally, the carbonyl chloride functional group indicates that it can act as an acylating agent, making it useful in various synthetic applications. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry and organic synthesis, although specific applications would depend on further research and characterization.
Formula:C18H13Cl2NO2
InChI:InChI=1S/C18H13Cl2NO2/c1-2-23-12-6-3-5-11(9-12)16-10-14(18(20)22)13-7-4-8-15(19)17(13)21-16/h3-10H,2H2,1H3
InChI key:InChIKey=QDPBIISCSWVAHL-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCC)=CC=C3)C(Cl)=CC=C2
Synonyms:- 8-Chloro-2-(3-ethoxyphenyl)-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 8-chloro-2-(3-ethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.