CAS 1160263-75-1

8-Chloro-2-(2-ethoxyphenyl)-4-quinolinecarbonyl chloride

Description:

8-Chloro-2-(2-ethoxyphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety, a chloro substituent, and an ethoxyphenyl group. This compound typically exhibits properties common to halogenated carbonyl compounds, such as reactivity towards nucleophiles due to the presence of the carbonyl chloride functional group. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, given the presence of the quinoline structure, which is known for its biological activity. The chloro group may enhance its reactivity, making it suitable for further chemical modifications. Additionally, the ethoxy group can influence its solubility and interaction with biological targets. Safety and handling precautions should be observed due to its potential reactivity and toxicity, as is common with many chlorinated organic compounds. Overall, this compound represents a valuable entity in the realm of organic synthesis and drug development.

Formula: C₁₈H₁₃Cl₂NO₂

InChI: InChI=1S/C18H13Cl2NO2/c1-2-23-16-9-4-3-6-12(16)15-10-13(18(20)22)11-7-5-8-14(19)17(11)21-15/h3-10H,2H2,1H3

InChI key: InChIKey=BVFKSTHDXJGDGO-UHFFFAOYSA-N

SMILES: O(CC)C1=C(C2=NC3=C(C(C(Cl)=O)=C2)C=CC=C3Cl)C=CC=C1

Synonyms:

• 8-Chloro-2-(2-ethoxyphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 8-chloro-2-(2-ethoxyphenyl)-