CymitQuimica logo

CAS 1160263-76-2

:

7-Chloro-2-(2-ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride

Description:
7-Chloro-2-(2-ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core, a chloro substituent, and an ethoxyphenyl group. This compound typically exhibits properties associated with halogenated organic molecules, such as potential reactivity due to the presence of the carbonyl chloride functional group, which can participate in nucleophilic substitution reactions. The quinoline moiety contributes to its aromatic character and may influence its solubility and stability in various solvents. Additionally, the presence of the ethoxy group can enhance lipophilicity, potentially affecting biological activity and interactions with other molecules. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could confer specific biological activities. However, detailed studies on its physical and chemical properties, such as melting point, boiling point, and spectral data, would be necessary to fully characterize its behavior in different environments.
Formula:C19H15Cl2NO2
InChI:InChI=1S/C19H15Cl2NO2/c1-3-24-17-7-5-4-6-13(17)16-10-14(19(21)23)12-8-9-15(20)11(2)18(12)22-16/h4-10H,3H2,1-2H3
InChI key:InChIKey=ZDFUQGMEXZFWKJ-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=C(OCC)C=CC=C3)C(C)=C(Cl)C=C2
Synonyms:
  • 7-Chloro-2-(2-ethoxyphenyl)-8-methyl-4-quinolinecarbonyl chloride
  • 4-Quinolinecarbonyl chloride, 7-chloro-2-(2-ethoxyphenyl)-8-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.