CAS 1160263-79-5
:8-Chloro-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride
Description:
8-Chloro-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety, a chloro substituent, and a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated organic compounds, such as increased reactivity due to the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. The presence of the propoxyphenyl group contributes to its hydrophobic characteristics, potentially influencing its solubility in organic solvents. The carbonyl chloride functional group suggests that it may act as an acylating agent, making it useful in various chemical syntheses. Additionally, compounds of this nature may exhibit biological activity, which could be explored in pharmaceutical applications. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable chemical databases for precise applications. Safety precautions should be observed when handling this compound due to its reactive nature.
Formula:C19H15Cl2NO2
InChI:InChI=1S/C19H15Cl2NO2/c1-2-9-24-13-6-3-5-12(10-13)17-11-15(19(21)23)14-7-4-8-16(20)18(14)22-17/h3-8,10-11H,2,9H2,1H3
InChI key:InChIKey=MXQKNTLMOKICTC-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCCC)=CC=C3)C(Cl)=CC=C2
Synonyms:- 4-Quinolinecarbonyl chloride, 8-chloro-2-(3-propoxyphenyl)-
- 8-Chloro-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride
- 8-chloro-2-(3-propoxyphenyl)quinoline-4-carbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.