CAS 1160263-80-8

7-Chloro-8-methyl-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride

Description:

7-Chloro-8-methyl-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This compound features a chloro substituent at the 7-position and a methyl group at the 8-position of the quinoline ring, contributing to its unique reactivity and potential biological activity. The presence of a propoxyphenyl group at the 2-position enhances its lipophilicity, which may influence its pharmacokinetic properties. The carbonyl chloride functional group indicates that it can undergo acylation reactions, making it a versatile intermediate in organic synthesis. This compound may exhibit various biological activities, potentially including antimicrobial or anticancer properties, although specific biological data would depend on empirical studies. Its molecular structure suggests it could interact with biological targets, making it of interest in medicinal chemistry. As with many synthetic compounds, safety and handling precautions should be observed due to the presence of reactive functional groups.

Formula: C₂₀H₁₇Cl₂NO₂

InChI: InChI=1S/C20H17Cl2NO2/c1-3-9-25-14-6-4-5-13(10-14)18-11-16(20(22)24)15-7-8-17(21)12(2)19(15)23-18/h4-8,10-11H,3,9H2,1-2H3

InChI key: InChIKey=GNBGRBKWNLPADJ-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OCCC)=CC=C3)C(C)=C(Cl)C=C2

Synonyms:

• 7-Chloro-8-methyl-2-(3-propoxyphenyl)-4-quinolinecarbonyl chloride
• 4-Quinolinecarbonyl chloride, 7-chloro-8-methyl-2-(3-propoxyphenyl)-