CAS 1160263-83-1

8-Chloro-2-[3-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride

Description:

8-Chloro-2-[3-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline moiety and a chloro substituent. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride, which can participate in various chemical reactions, particularly acylation. The presence of the 1-methylethoxy group contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity in organic solvents. The chloro substituent may also enhance its electrophilic properties, making it useful in synthetic organic chemistry for the introduction of other functional groups. This compound is likely to be of interest in pharmaceutical research or as an intermediate in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound due to its reactive nature and potential toxicity associated with the chloro and carbonyl functionalities. As with all chemical substances, proper characterization through techniques such as NMR, IR, and mass spectrometry is essential for confirming its identity and purity.

Formula: C₁₉H₁₅Cl₂NO₂

InChI: InChI=1S/C19H15Cl2NO2/c1-11(2)24-13-6-3-5-12(9-13)17-10-15(19(21)23)14-7-4-8-16(20)18(14)22-17/h3-11H,1-2H3

InChI key: InChIKey=ZMWLLPOOMCYAHV-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OC(C)C)=CC=C3)C(Cl)=CC=C2

Synonyms:

• 4-Quinolinecarbonyl chloride, 8-chloro-2-[3-(1-methylethoxy)phenyl]-
• 8-Chloro-2-[3-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride