CAS 1160263-84-2
:7-Chloro-8-methyl-2-[3-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride
Description:
7-Chloro-8-methyl-2-[3-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with various functional groups. The presence of a chloro group at the 7-position and a methyl group at the 8-position of the quinoline ring contributes to its reactivity and potential biological activity. The compound also features a phenyl group with an ethoxy substituent, which may influence its solubility and interaction with biological targets. As a carbonyl chloride, it is likely to be reactive, particularly towards nucleophiles, making it useful in synthetic chemistry for the formation of amides or other derivatives. The compound's unique structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Safety considerations are important due to the presence of reactive functional groups, and handling should be conducted with appropriate precautions in a controlled laboratory environment.
Formula:C20H17Cl2NO2
InChI:InChI=1S/C20H17Cl2NO2/c1-11(2)25-14-6-4-5-13(9-14)18-10-16(20(22)24)15-7-8-17(21)12(3)19(15)23-18/h4-11H,1-3H3
InChI key:InChIKey=IRCRGROLOGYWHJ-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C=1C2=C(N=C(C1)C3=CC(OC(C)C)=CC=C3)C(C)=C(Cl)C=C2
Synonyms:- 7-Chloro-8-methyl-2-[3-(1-methylethoxy)phenyl]-4-quinolinecarbonyl chloride
- 4-Quinolinecarbonyl chloride, 7-chloro-8-methyl-2-[3-(1-methylethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.