CymitQuimica logo

CAS 1160263-98-8

:

3-(1,3-Dihydro-2H-isoindol-2-yl)benzenamine

Description:
3-(1,3-Dihydro-2H-isoindol-2-yl)benzenamine, identified by its CAS number 1160263-98-8, is an organic compound characterized by its unique structure, which features a benzenamine moiety linked to a 1,3-dihydro-2H-isoindole. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the isoindole structure may impart specific reactivity, including potential interactions with electrophiles or nucleophiles. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests that it could participate in hydrogen bonding and π-π stacking interactions, which are relevant in biological systems. As with many organic compounds, safety and handling precautions should be observed, particularly due to the potential toxicity associated with amine groups. Overall, 3-(1,3-Dihydro-2H-isoindol-2-yl)benzenamine represents a compound with intriguing chemical properties and potential applications in various fields.
Formula:C14H14N2
InChI:InChI=1S/C14H14N2/c15-13-6-3-7-14(8-13)16-9-11-4-1-2-5-12(11)10-16/h1-8H,9-10,15H2
InChI key:InChIKey=GVTTYJQILUUYSQ-UHFFFAOYSA-N
SMILES:NC=1C=C(N2CC=3C(C2)=CC=CC3)C=CC1
Synonyms:
  • 3-(1,3-Dihydro-2H-isoindol-2-yl)benzenamine
  • Benzenamine, 3-(1,3-dihydro-2H-isoindol-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.