CAS 1160263-99-9: 4-(3-Aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione
Description:4-(3-Aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione, identified by its CAS number 1160263-99-9, is a synthetic organic compound characterized by its triazolidine core structure, which features a five-membered ring containing three nitrogen atoms. This compound exhibits a range of functional groups, including an amine and two carbonyl groups, contributing to its potential reactivity and biological activity. The presence of the 3-aminophenyl group suggests that it may engage in hydrogen bonding and other interactions, making it of interest in medicinal chemistry. Its molecular structure indicates potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. The compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, this compound represents a class of triazolidine derivatives that may hold promise for further research and application in drug development.
Formula:C10H12N4O2
InChI:InChI=1S/C10H12N4O2/c1-12-9(15)14(10(16)13(12)2)8-5-3-4-7(11)6-8/h3-6H,11H2,1-2H3
InChI key:InChIKey=LABROZRLPSCPEO-UHFFFAOYSA-N
SMILES:O=C1N(C=2C=CC=C(N)C2)C(=O)N(N1C)C
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4-(3-aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione REF: IN-DA008V55CAS: 1160263-99-9 | - - - | To inquire | Tue 11 Mar 25 |
 | 4-(3-aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione REF: 10-F307328CAS: 1160263-99-9 | 95.0% | To inquire | Fri 21 Mar 25 |
 | 4-(3-Aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione REF: 3D-FA120307CAS: 1160263-99-9 | Min. 95% | - - - | Discontinued product |
4-(3-aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione
Ref: IN-DA008V55
| Undefined size | To inquire |
4-(3-aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione
Ref: 10-F307328
| 1g | To inquire |
4-(3-Aminophenyl)-1,2-dimethyl-1,2,4-triazolidine-3,5-dione
Ref: 3D-FA120307
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
