CAS 1160264-01-6

5-Amino-N-methylbenzo[b]thiophene-2-carboxamide

Description:

5-Amino-N-methylbenzo[b]thiophene-2-carboxamide is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core substituted with an amino group and a carboxamide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the amino and carboxamide groups. The amino group can participate in hydrogen bonding, influencing its solubility and interaction with biological systems. The methyl group attached to the nitrogen atom may affect the compound's lipophilicity and overall pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its specific applications and behavior would depend on further studies, including its synthesis, reactivity, and interaction with biological targets. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₁₀H₁₀N₂OS

InChI: InChI=1S/C10H10N2OS/c1-12-10(13)9-5-6-4-7(11)2-3-8(6)14-9/h2-5H,11H2,1H3,(H,12,13)

InChI key: InChIKey=FHARQFBENYPJGX-UHFFFAOYSA-N

SMILES: C(NC)(=O)C=1SC=2C(C1)=CC(N)=CC2

Synonyms:

• Benzo[b]thiophene-2-carboxamide, 5-amino-N-methyl-
• 5-Amino-N-methylbenzo[b]thiophene-2-carboxamide