CymitQuimica logo

CAS 1160264-02-7

:

1,2,3,4-Tetrahydro-6,7-dimethoxy-2-oxo-4-quinolineacetic acid

Description:
1,2,3,4-Tetrahydro-6,7-dimethoxy-2-oxo-4-quinolineacetic acid is a chemical compound characterized by its unique quinoline structure, which includes a tetrahydro ring system and two methoxy groups. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the 2-oxo group indicates that it has a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions. The methoxy groups enhance its solubility in organic solvents and may influence its biological activity. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, particularly in the development of therapeutic agents. Its molecular structure suggests that it may interact with biological targets, making it a candidate for further research in drug discovery. Additionally, the compound's stability, reactivity, and potential applications in various fields, including pharmaceuticals and agrochemicals, warrant further investigation. However, specific data regarding its biological activity, toxicity, and synthesis may require additional research and validation.
Formula:C13H15NO5
InChI:InChI=1S/C13H15NO5/c1-18-10-5-8-7(4-13(16)17)3-12(15)14-9(8)6-11(10)19-2/h5-7H,3-4H2,1-2H3,(H,14,15)(H,16,17)
InChI key:InChIKey=MGHAPYBRWPXHSP-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1C=2C(=CC(OC)=C(OC)C2)NC(=O)C1
Synonyms:
  • 1,2,3,4-Tetrahydro-6,7-dimethoxy-2-oxo-4-quinolineacetic acid
  • 4-Quinolineacetic acid, 1,2,3,4-tetrahydro-6,7-dimethoxy-2-oxo-
  • 2-(6,7-dimethoxy-2-oxo-3,4-dihydro-1H-quinolin-4-yl)acetic acid
  • (6,7-dimethoxy-2-oxo-1,2,3,4-tetrahydroquinolin-4-yl)acetic acid
  • 4-quinolineacetic acid, 1,2,3,4-tetrahydro-6,7-dimethoxy-2
Found 0 products.