CymitQuimica logo

CAS 1160264-03-8

:

N-Hydroxy-2-(hydroxyimino)pentanimidamide

Description:
N-Hydroxy-2-(hydroxyimino)pentanimidamide, identified by its CAS number 1160264-03-8, is a chemical compound characterized by the presence of both hydroxyl and hydroxyimino functional groups, which contribute to its reactivity and potential applications in various chemical processes. This compound features a pentanimidamide backbone, indicating that it contains a five-carbon chain with an amide functional group, which is known for its ability to form hydrogen bonds and participate in various chemical reactions. The presence of the N-hydroxy and hydroxyimino groups suggests that this substance may exhibit properties such as enhanced solubility in polar solvents and potential biological activity, making it of interest in medicinal chemistry and synthetic applications. Additionally, the structural features may allow for interactions with biological targets, which could be explored for therapeutic purposes. Overall, N-Hydroxy-2-(hydroxyimino)pentanimidamide represents a unique compound with potential utility in both research and industrial applications.
Formula:C5H11N3O2
InChI:InChI=1S/C5H11N3O2/c1-2-3-4(7-9)5(6)8-10/h9-10H,2-3H2,1H3,(H2,6,8)
InChI key:InChIKey=CIYTYIRJXZEZEB-UHFFFAOYSA-N
SMILES:C(C(NO)=N)(CCC)=NO
Synonyms:
  • Pentanimidamide, N-hydroxy-2-(hydroxyimino)-
  • N-Hydroxy-2-(hydroxyimino)pentanimidamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.