CAS 1160264-04-9

Ethyl 6-formylpyrazolo[1,5-a]pyrimidine-3-carboxylate

Description:

Ethyl 6-formylpyrazolo[1,5-a]pyrimidine-3-carboxylate is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both a formyl group and an ethyl ester functionality. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is soluble in common organic solvents such as ethanol and dimethyl sulfoxide, but may have limited solubility in water due to its hydrophobic characteristics. The presence of the formyl group suggests potential reactivity, particularly in condensation reactions, while the carboxylate moiety can participate in various chemical transformations, including esterification and amidation. Ethyl 6-formylpyrazolo[1,5-a]pyrimidine-3-carboxylate may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features allow for potential interactions with biological targets, which could lead to the synthesis of novel therapeutic agents. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.

Formula: C₁₀H₉N₃O₃

InChI: InChI=1S/C10H9N3O3/c1-2-16-10(15)8-4-12-13-5-7(6-14)3-11-9(8)13/h3-6H,2H2,1H3

InChI key: InChIKey=TZUNKGZQWMSNBR-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C2N(C=C(C=O)C=N2)N=C1

Synonyms:

• Ethyl 6-formylpyrazolo[1,5-a]pyrimidine-3-carboxylate
• Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 6-formyl-, ethyl ester