CymitQuimica logo

CAS 1160264-05-0

:

3-Phenylpyrazolo[1,5-a]pyrimidine-6-carboxaldehyde

Description:
3-Phenylpyrazolo[1,5-a]pyrimidine-6-carboxaldehyde is a heterocyclic organic compound characterized by its fused pyrazole and pyrimidine rings, which contribute to its unique chemical properties. This compound features a phenyl group attached to the pyrazole moiety and an aldehyde functional group at the 6-position of the pyrimidine ring, making it a versatile building block in organic synthesis. Its structure allows for potential reactivity in various chemical reactions, including nucleophilic additions and condensation reactions, due to the presence of the aldehyde group. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Additionally, its solubility and stability can vary depending on the solvent and conditions, which is important for its application in research and industry. Overall, 3-Phenylpyrazolo[1,5-a]pyrimidine-6-carboxaldehyde represents a significant compound in the field of organic chemistry, with potential implications in pharmaceuticals and material science.
Formula:C13H9N3O
InChI:InChI=1S/C13H9N3O/c17-9-10-6-14-13-12(7-15-16(13)8-10)11-4-2-1-3-5-11/h1-9H
InChI key:InChIKey=XJIDIIQALIVUPK-UHFFFAOYSA-N
SMILES:C(=O)C1=CN2C(=C(C=N2)C3=CC=CC=C3)N=C1
Synonyms:
  • Pyrazolo[1,5-a]pyrimidine-6-carboxaldehyde, 3-phenyl-
  • 3-Phenylpyrazolo[1,5-a]pyrimidine-6-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.