CAS 1160264-09-4
:5-Oxo-1-(1-phenylethyl)-3-pyrrolidinecarbonyl chloride
Description:
5-Oxo-1-(1-phenylethyl)-3-pyrrolidinecarbonyl chloride is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a carbonyl chloride functional group indicates that it is a derivative of an acyl chloride, making it reactive and useful in various synthetic applications, particularly in the formation of amides and esters. The compound features a phenylethyl substituent, which contributes to its potential biological activity and may influence its interactions in chemical reactions. Its molecular structure suggests that it may exhibit properties typical of both carbonyl compounds and nitrogen heterocycles, such as nucleophilicity and electrophilicity. Additionally, the presence of the carbonyl chloride group implies that it may be sensitive to moisture and should be handled with care to avoid hydrolysis. Overall, this compound is of interest in organic synthesis and medicinal chemistry, where its reactivity can be harnessed for the development of more complex molecules.
Formula:C13H14ClNO2
InChI:InChI=1S/C13H14ClNO2/c1-9(10-5-3-2-4-6-10)15-8-11(13(14)17)7-12(15)16/h2-6,9,11H,7-8H2,1H3
InChI key:InChIKey=GLQDYQMUQCZQTC-UHFFFAOYSA-N
SMILES:C(C)(N1CC(C(Cl)=O)CC1=O)C2=CC=CC=C2
Synonyms:- 3-Pyrrolidinecarbonyl chloride, 5-oxo-1-(1-phenylethyl)-
- 5-Oxo-1-(1-phenylethyl)-3-pyrrolidinecarbonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.