CAS 1160264-10-7
:1-(4-Methyl-2-nitrophenyl)-5-oxo-3-pyrrolidinecarboxylic acid
Description:
1-(4-Methyl-2-nitrophenyl)-5-oxo-3-pyrrolidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and functional groups such as a carboxylic acid and a nitrophenyl moiety. The presence of the 4-methyl-2-nitrophenyl group suggests that the compound may exhibit specific electronic and steric properties, potentially influencing its reactivity and interactions with biological systems. The oxo group contributes to the compound's acidity and may play a role in its chemical behavior. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for the development of pharmaceuticals or agrochemicals. Additionally, its CAS number, 1160264-10-7, allows for precise identification in chemical databases, facilitating research and application in various fields. Overall, the characteristics of this compound suggest potential utility in synthetic chemistry and biological applications, warranting further investigation into its properties and effects.
Formula:C12H12N2O5
InChI:InChI=1S/C12H12N2O5/c1-7-2-3-9(10(4-7)14(18)19)13-6-8(12(16)17)5-11(13)15/h2-4,8H,5-6H2,1H3,(H,16,17)
InChI key:InChIKey=GIYVNRRHVAOLEB-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C=CC(C)=C1)N2CC(C(O)=O)CC2=O
Synonyms:- 3-Pyrrolidinecarboxylic acid, 1-(4-methyl-2-nitrophenyl)-5-oxo-
- 1-(4-Methyl-2-nitrophenyl)-5-oxo-3-pyrrolidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.